C11H8O4S2 — CID 125350105
2-methylsulfonylsulfanylnaphthalene-1,4-dione (PubChem CID 125350105) has the molecular formula C11H8O4S2 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-methylsulfonylsulfanylnaphthalene-1,4-dione.
| Compound Name | 2-methylsulfonylsulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 125350105 |
| Molecular Formula | C11H8O4S2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 267.99 |
| IUPAC Name | 2-methylsulfonylsulfanylnaphthalene-1,4-dione |
| SMILES | CS(=O)(=O)SC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8O4S2/c1-17(14,15)16-10-6-9(12)7-4-2-3-5-8(7)11(10)13/h2-6H,1H3 |
| InChIKey | WNRGIIJGHAOVAP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|