C11H8N2O2S — CID 134894772
(1,4-dioxonaphthalen-2-yl) carbamimidothioate (PubChem CID 134894772) has the molecular formula C11H8N2O2S and a molecular weight of 232.26 g/mol. Its IUPAC name is (1,4-dioxonaphthalen-2-yl) carbamimidothioate.
| Compound Name | (1,4-dioxonaphthalen-2-yl) carbamimidothioate |
|---|---|
| PubChem CID | 134894772 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (1,4-dioxonaphthalen-2-yl) carbamimidothioate |
| SMILES | [H]/N=C(\N)SC1=CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C11H8N2O2S/c12-11(13)16-9-5-8(14)6-3-1-2-4-7(6)10(9)15/h1-5H,(H3,12,13) |
| InChIKey | QQPJCEGSUFYTCE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|