About (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide
(2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide (PubChem CID 68874096) has the molecular formula C8H12I2N4S2
and a molecular weight of 482.15 g/mol. Its IUPAC name is (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide.
Molecular Properties
| Compound Name | (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide |
| PubChem CID | 68874096 |
| Molecular Formula | C8H12I2N4S2 |
| Molecular Weight | 482.15 g/mol |
| Exact Mass | 481.86 |
| IUPAC Name | (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide |
| SMILES | I.I.[H]/N=C(\N)Sc1ccccc1S/C(N)=N/[H] |
| InChI | InChI=1S/C8H10N4S2.2HI/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12;;/h1-4H,(H3,9,10)(H3,11,12);2*1H |
| InChIKey | NDFNZPUQVBBOHX-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 482.15 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide?
The IUPAC name of (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide (CID 68874096) is (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide.
What is the SMILES notation for (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide?
The canonical SMILES for (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide is I.I.[H]/N=C(\N)Sc1ccccc1S/C(N)=N/[H].
What is the InChIKey of (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide?
The InChIKey is NDFNZPUQVBBOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4S2.2HI/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12;;/h1-4H,(H3,9,10)(H3,11,12);2*1H.
What are the key properties of (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide?
(2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide has a molecular weight of 482.15 g/mol, XLogP of 2.89, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-carbamimidoylsulfanylphenyl) carbamimidothioate;dihydroiodide is sourced from PubChem (CID 68874096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).