C8H10N2O3S — CID 45093322
(2,5-dihydroxy-4-methoxyphenyl) carbamimidothioate (PubChem CID 45093322) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is (2,5-dihydroxy-4-methoxyphenyl) carbamimidothioate.
| Compound Name | (2,5-dihydroxy-4-methoxyphenyl) carbamimidothioate |
|---|---|
| PubChem CID | 45093322 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | (2,5-dihydroxy-4-methoxyphenyl) carbamimidothioate |
| SMILES | [H]/N=C(\N)Sc1cc(O)c(OC)cc1O |
| InChI | InChI=1S/C8H10N2O3S/c1-13-6-2-5(12)7(3-4(6)11)14-8(9)10/h2-3,11-12H,1H3,(H3,9,10) |
| InChIKey | XKJCPGYYIWBZEX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 99.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|