C8H9IO3 — CID 10850321
4-iodo-2,5-dimethoxyphenol (PubChem CID 10850321) has the molecular formula C8H9IO3 and a molecular weight of 280.06 g/mol. Its IUPAC name is 4-iodo-2,5-dimethoxyphenol.
| Compound Name | 4-iodo-2,5-dimethoxyphenol |
|---|---|
| PubChem CID | 10850321 |
| Molecular Formula | C8H9IO3 |
| Molecular Weight | 280.06 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 4-iodo-2,5-dimethoxyphenol |
| SMILES | COc1cc(I)c(OC)cc1O |
| InChI | InChI=1S/C8H9IO3/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4,10H,1-2H3 |
| InChIKey | YDOVPVLELMQBOP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.06 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|