About 5-iodo-2,4-dimethoxybenzenethiol
5-iodo-2,4-dimethoxybenzenethiol (PubChem CID 91874704) has the molecular formula C8H9IO2S
and a molecular weight of 296.13 g/mol. Its IUPAC name is 5-iodo-2,4-dimethoxybenzenethiol.
Molecular Properties
| Compound Name | 5-iodo-2,4-dimethoxybenzenethiol |
| PubChem CID | 91874704 |
| Molecular Formula | C8H9IO2S |
| Molecular Weight | 296.13 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | 5-iodo-2,4-dimethoxybenzenethiol |
| SMILES | COc1cc(OC)c(I)cc1S |
| InChI | InChI=1S/C8H9IO2S/c1-10-6-4-7(11-2)8(12)3-5(6)9/h3-4,12H,1-2H3 |
| InChIKey | KQRPVJSUHLGYME-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.13 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-2,4-dimethoxybenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-2,4-dimethoxybenzenethiol?
The IUPAC name of 5-iodo-2,4-dimethoxybenzenethiol (CID 91874704) is 5-iodo-2,4-dimethoxybenzenethiol.
What is the SMILES notation for 5-iodo-2,4-dimethoxybenzenethiol?
The canonical SMILES for 5-iodo-2,4-dimethoxybenzenethiol is COc1cc(OC)c(I)cc1S.
What is the InChIKey of 5-iodo-2,4-dimethoxybenzenethiol?
The InChIKey is KQRPVJSUHLGYME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9IO2S/c1-10-6-4-7(11-2)8(12)3-5(6)9/h3-4,12H,1-2H3.
What are the key properties of 5-iodo-2,4-dimethoxybenzenethiol?
5-iodo-2,4-dimethoxybenzenethiol has a molecular weight of 296.13 g/mol, XLogP of 2.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-2,4-dimethoxybenzenethiol is sourced from PubChem (CID 91874704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).