C10H14O3 — CID 5314475
2-methoxy-5-propylbenzene-1,4-diol (PubChem CID 5314475) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 2-methoxy-5-propylbenzene-1,4-diol.
| Compound Name | 2-methoxy-5-propylbenzene-1,4-diol |
|---|---|
| PubChem CID | 5314475 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 2-methoxy-5-propylbenzene-1,4-diol |
| SMILES | CCCc1cc(O)c(OC)cc1O |
| InChI | InChI=1S/C10H14O3/c1-3-4-7-5-9(12)10(13-2)6-8(7)11/h5-6,11-12H,3-4H2,1-2H3 |
| InChIKey | NVIGPNWNKIZMES-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|