C11H16O2 — CID 162375149
2,5-diethyl-4-methoxyphenol (PubChem CID 162375149) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,5-diethyl-4-methoxyphenol.
| Compound Name | 2,5-diethyl-4-methoxyphenol |
|---|---|
| PubChem CID | 162375149 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2,5-diethyl-4-methoxyphenol |
| SMILES | CCc1cc(OC)c(CC)cc1O |
| InChI | InChI=1S/C11H16O2/c1-4-8-7-11(13-3)9(5-2)6-10(8)12/h6-7,12H,4-5H2,1-3H3 |
| InChIKey | IDGXRDQQQUUXCH-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |