C8H8I2O3 — CID 10501483
2,6-diiodo-3,5-dimethoxyphenol (PubChem CID 10501483) has the molecular formula C8H8I2O3 and a molecular weight of 405.96 g/mol. Its IUPAC name is 2,6-diiodo-3,5-dimethoxyphenol.
| Compound Name | 2,6-diiodo-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 10501483 |
| Molecular Formula | C8H8I2O3 |
| Molecular Weight | 405.96 g/mol |
| Exact Mass | 405.86 |
| IUPAC Name | 2,6-diiodo-3,5-dimethoxyphenol |
| SMILES | COc1cc(OC)c(I)c(O)c1I |
| InChI | InChI=1S/C8H8I2O3/c1-12-4-3-5(13-2)7(10)8(11)6(4)9/h3,11H,1-2H3 |
| InChIKey | DIYLXGJNDOKFPL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.96 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|