C10H10I2O — CID 166018938
2,5-diiodo-1-methoxy-3-prop-1-en-2-ylbenzene (PubChem CID 166018938) has the molecular formula C10H10I2O and a molecular weight of 400.00 g/mol. Its IUPAC name is 2,5-diiodo-1-methoxy-3-prop-1-en-2-ylbenzene.
| Compound Name | 2,5-diiodo-1-methoxy-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 166018938 |
| Molecular Formula | C10H10I2O |
| Molecular Weight | 400.00 g/mol |
| Exact Mass | 399.88 |
| IUPAC Name | 2,5-diiodo-1-methoxy-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1cc(I)cc(OC)c1I |
| InChI | InChI=1S/C10H10I2O/c1-6(2)8-4-7(11)5-9(13-3)10(8)12/h4-5H,1H2,2-3H3 |
| InChIKey | ZCPIZUDSXPZULG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.00 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|