C9H8I2O4 — CID 118996626
2-(2,5-diiodo-3-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 118996626) has the molecular formula C9H8I2O4 and a molecular weight of 433.97 g/mol. Its IUPAC name is 2-(2,5-diiodo-3-methoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,5-diiodo-3-methoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118996626 |
| Molecular Formula | C9H8I2O4 |
| Molecular Weight | 433.97 g/mol |
| Exact Mass | 433.85 |
| IUPAC Name | 2-(2,5-diiodo-3-methoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1cc(I)cc(C(O)C(=O)O)c1I |
| InChI | InChI=1S/C9H8I2O4/c1-15-6-3-4(10)2-5(7(6)11)8(12)9(13)14/h2-3,8,12H,1H3,(H,13,14) |
| InChIKey | PMRHQROXROBFQM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.97 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|