C12H16O5 — CID 117352962
2-(5-ethyl-2,3-dimethoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117352962) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 2-(5-ethyl-2,3-dimethoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(5-ethyl-2,3-dimethoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117352962 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(5-ethyl-2,3-dimethoxyphenyl)-2-hydroxyacetic acid |
| SMILES | CCc1cc(OC)c(OC)c(C(O)C(=O)O)c1 |
| InChI | InChI=1S/C12H16O5/c1-4-7-5-8(10(13)12(14)15)11(17-3)9(6-7)16-2/h5-6,10,13H,4H2,1-3H3,(H,14,15) |
| InChIKey | MVFHGPGOTNFQFW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |