About CID 59316225
CID 59316225 (PubChem CID 59316225) has the molecular formula C11H14NO2
and a molecular weight of 192.24 g/mol.
Molecular Properties
| Compound Name | CID 59316225 |
| PubChem CID | 59316225 |
| Molecular Formula | C11H14NO2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | — |
| SMILES | C=C(C)c1cc(OC)c(OC)cc1[NH] |
| InChI | InChI=1S/C11H14NO2/c1-7(2)8-5-10(13-3)11(14-4)6-9(8)12/h5-6,12H,1H2,2-4H3 |
| InChIKey | SKUJXGIXGSIXLH-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 59316225 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59316225?
The IUPAC name of CID 59316225 (CID 59316225) is not available.
What is the SMILES notation for CID 59316225?
The canonical SMILES for CID 59316225 is C=C(C)c1cc(OC)c(OC)cc1[NH].
What is the InChIKey of CID 59316225?
The InChIKey is SKUJXGIXGSIXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO2/c1-7(2)8-5-10(13-3)11(14-4)6-9(8)12/h5-6,12H,1H2,2-4H3.
What are the key properties of CID 59316225?
CID 59316225 has a molecular weight of 192.24 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59316225 is sourced from PubChem (CID 59316225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).