C10H12O4P2 — CID 70886468
(2,5-dimethoxy-4-phosphanylcarbonylphenyl)-phosphanylmethanone (PubChem CID 70886468) has the molecular formula C10H12O4P2 and a molecular weight of 258.15 g/mol. Its IUPAC name is (2,5-dimethoxy-4-phosphanylcarbonylphenyl)-phosphanylmethanone.
| Compound Name | (2,5-dimethoxy-4-phosphanylcarbonylphenyl)-phosphanylmethanone |
|---|---|
| PubChem CID | 70886468 |
| Molecular Formula | C10H12O4P2 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (2,5-dimethoxy-4-phosphanylcarbonylphenyl)-phosphanylmethanone |
| SMILES | COc1cc(C(=O)P)c(OC)cc1C(=O)P |
| InChI | InChI=1S/C10H12O4P2/c1-13-7-3-6(10(12)16)8(14-2)4-5(7)9(11)15/h3-4H,15-16H2,1-2H3 |
| InChIKey | SEWIPXZIHDCASE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|