C9H9O5- — CID 86306376
2-carboxy-4,5-dimethoxyphenolate (PubChem CID 86306376) has the molecular formula C9H9O5- and a molecular weight of 197.17 g/mol. Its IUPAC name is 2-carboxy-4,5-dimethoxyphenolate.
| Compound Name | 2-carboxy-4,5-dimethoxyphenolate |
|---|---|
| PubChem CID | 86306376 |
| Molecular Formula | C9H9O5- |
| Molecular Weight | 197.17 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-carboxy-4,5-dimethoxyphenolate |
| SMILES | COc1cc([O-])c(C(=O)O)cc1OC |
| InChI | InChI=1S/C9H10O5/c1-13-7-3-5(9(11)12)6(10)4-8(7)14-2/h3-4,10H,1-2H3,(H,11,12)/p-1 |
| InChIKey | RUBXSZYVSFYJQR-UHFFFAOYSA-M |
| XLogP | 0.48 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |