About CID 171375610
CID 171375610 (PubChem CID 171375610) has the molecular formula C26H25O4Sn-
and a molecular weight of 520.19 g/mol.
Molecular Properties
| Compound Name | CID 171375610 |
| PubChem CID | 171375610 |
| Molecular Formula | C26H25O4Sn- |
| Molecular Weight | 520.19 g/mol |
| Exact Mass | 521.08 |
| IUPAC Name | — |
| SMILES | COc1ccc([O-])c(C(=O)O)c1.[Sn].c1ccccc1.c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C8H8O4.3C6H6.Sn/c1-12-5-2-3-7(9)6(4-5)8(10)11;3*1-2-4-6-5-3-1;/h2-4,9H,1H3,(H,10,11);3*1-6H;/p-1 |
| InChIKey | CSDZVGPHMUXTJX-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.19 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 171375610 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171375610?
The IUPAC name of CID 171375610 (CID 171375610) is not available.
What is the SMILES notation for CID 171375610?
The canonical SMILES for CID 171375610 is COc1ccc([O-])c(C(=O)O)c1.[Sn].c1ccccc1.c1ccccc1.c1ccccc1.
What is the InChIKey of CID 171375610?
The InChIKey is CSDZVGPHMUXTJX-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8O4.3C6H6.Sn/c1-12-5-2-3-7(9)6(4-5)8(10)11;3*1-2-4-6-5-3-1;/h2-4,9H,1H3,(H,10,11);3*1-6H;/p-1.
What are the key properties of CID 171375610?
CID 171375610 has a molecular weight of 520.19 g/mol, XLogP of 5.15, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171375610 is sourced from PubChem (CID 171375610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).