C9H13ClN2O4 — CID 170985236
2-hydrazinyl-4,5-dimethoxybenzoic acid;hydrochloride (PubChem CID 170985236) has the molecular formula C9H13ClN2O4 and a molecular weight of 248.67 g/mol. Its IUPAC name is 2-hydrazinyl-4,5-dimethoxybenzoic acid;hydrochloride.
| Compound Name | 2-hydrazinyl-4,5-dimethoxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 170985236 |
| Molecular Formula | C9H13ClN2O4 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-hydrazinyl-4,5-dimethoxybenzoic acid;hydrochloride |
| SMILES | COc1cc(NN)c(C(=O)O)cc1OC.Cl |
| InChI | InChI=1S/C9H12N2O4.ClH/c1-14-7-3-5(9(12)13)6(11-10)4-8(7)15-2;/h3-4,11H,10H2,1-2H3,(H,12,13);1H |
| InChIKey | ITMGSMSAJZVCDX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|