C13H16O6 — CID 116918258
2-methyl-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoic acid (PubChem CID 116918258) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is 2-methyl-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoic acid.
| Compound Name | 2-methyl-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 116918258 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methyl-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoic acid |
| SMILES | COc1cc(OC)c(C(=O)C(C)C(=O)O)cc1OC |
| InChI | InChI=1S/C13H16O6/c1-7(13(15)16)12(14)8-5-10(18-3)11(19-4)6-9(8)17-2/h5-7H,1-4H3,(H,15,16) |
| InChIKey | ZRIUNODWIVGOFN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|