C14H17NO4 — CID 43670546
2-(2,4,5-trimethoxybenzoyl)butanenitrile (PubChem CID 43670546) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 2-(2,4,5-trimethoxybenzoyl)butanenitrile.
| Compound Name | 2-(2,4,5-trimethoxybenzoyl)butanenitrile |
|---|---|
| PubChem CID | 43670546 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-(2,4,5-trimethoxybenzoyl)butanenitrile |
| SMILES | CCC(C#N)C(=O)c1cc(OC)c(OC)cc1OC |
| InChI | InChI=1S/C14H17NO4/c1-5-9(8-15)14(16)10-6-12(18-3)13(19-4)7-11(10)17-2/h6-7,9H,5H2,1-4H3 |
| InChIKey | CXDHQOXKZYXZFV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|