C12H11F2NO2 — CID 116923745
2-(2,5-difluoro-4-methoxybenzoyl)butanenitrile (PubChem CID 116923745) has the molecular formula C12H11F2NO2 and a molecular weight of 239.22 g/mol. Its IUPAC name is 2-(2,5-difluoro-4-methoxybenzoyl)butanenitrile.
| Compound Name | 2-(2,5-difluoro-4-methoxybenzoyl)butanenitrile |
|---|---|
| PubChem CID | 116923745 |
| Molecular Formula | C12H11F2NO2 |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(2,5-difluoro-4-methoxybenzoyl)butanenitrile |
| SMILES | CCC(C#N)C(=O)c1cc(F)c(OC)cc1F |
| InChI | InChI=1S/C12H11F2NO2/c1-3-7(6-15)12(16)8-4-10(14)11(17-2)5-9(8)13/h4-5,7H,3H2,1-2H3 |
| InChIKey | QPEXKKNFDOFAJF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|