C12H15NO3 — CID 165346221
N-(4,5-dimethoxy-2-prop-1-en-2-ylphenyl)formamide (PubChem CID 165346221) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is N-(4,5-dimethoxy-2-prop-1-en-2-ylphenyl)formamide.
| Compound Name | N-(4,5-dimethoxy-2-prop-1-en-2-ylphenyl)formamide |
|---|---|
| PubChem CID | 165346221 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-(4,5-dimethoxy-2-prop-1-en-2-ylphenyl)formamide |
| SMILES | C=C(C)c1cc(OC)c(OC)cc1NC=O |
| InChI | InChI=1S/C12H15NO3/c1-8(2)9-5-11(15-3)12(16-4)6-10(9)13-7-14/h5-7H,1H2,2-4H3,(H,13,14) |
| InChIKey | VZKDLMOZSPWGLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|