C19H25NO3 — CID 168652825
N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]formamide (PubChem CID 168652825) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]formamide.
| Compound Name | N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]formamide |
|---|---|
| PubChem CID | 168652825 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]formamide |
| SMILES | COc1cc(NC=O)c(C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C19H25NO3/c1-22-17-6-15(16(20-11-21)7-18(17)23-2)19-8-12-3-13(9-19)5-14(4-12)10-19/h6-7,11-14H,3-5,8-10H2,1-2H3,(H,20,21) |
| InChIKey | WYBIIFUQDQTMGG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|