C25H31NO4S — CID 169372072
N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-methylbenzenesulfonamide (PubChem CID 169372072) has the molecular formula C25H31NO4S and a molecular weight of 441.59 g/mol. Its IUPAC name is N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 169372072 |
| Molecular Formula | C25H31NO4S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.20 |
| IUPAC Name | N-[2-(1-adamantyl)-4,5-dimethoxyphenyl]-4-methylbenzenesulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(C)cc2)c(C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C25H31NO4S/c1-16-4-6-20(7-5-16)31(27,28)26-22-12-24(30-3)23(29-2)11-21(22)25-13-17-8-18(14-25)10-19(9-17)15-25/h4-7,11-12,17-19,26H,8-10,13-15H2,1-3H3 |
| InChIKey | KUZLKWLHBCGFHL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |