C22H22N2O4S2 — CID 10718059
N-[2,5-dimethoxy-4-[(4-methylphenyl)sulfonylamino]phenyl]benzenecarbothioamide (PubChem CID 10718059) has the molecular formula C22H22N2O4S2 and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[2,5-dimethoxy-4-[(4-methylphenyl)sulfonylamino]phenyl]benzenecarbothioamide.
| Compound Name | N-[2,5-dimethoxy-4-[(4-methylphenyl)sulfonylamino]phenyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 10718059 |
| Molecular Formula | C22H22N2O4S2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | N-[2,5-dimethoxy-4-[(4-methylphenyl)sulfonylamino]phenyl]benzenecarbothioamide |
| SMILES | COc1cc(NS(=O)(=O)c2ccc(C)cc2)c(OC)cc1NC(=S)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O4S2/c1-15-9-11-17(12-10-15)30(25,26)24-19-14-20(27-2)18(13-21(19)28-3)23-22(29)16-7-5-4-6-8-16/h4-14,24H,1-3H3,(H,23,29) |
| InChIKey | SPBSUOIKNYVZDA-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|