C10H9IO2 — CID 134860651
5-ethynyl-2-iodo-1,3-dimethoxybenzene (PubChem CID 134860651) has the molecular formula C10H9IO2 and a molecular weight of 288.08 g/mol. Its IUPAC name is 5-ethynyl-2-iodo-1,3-dimethoxybenzene.
| Compound Name | 5-ethynyl-2-iodo-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 134860651 |
| Molecular Formula | C10H9IO2 |
| Molecular Weight | 288.08 g/mol |
| Exact Mass | 287.96 |
| IUPAC Name | 5-ethynyl-2-iodo-1,3-dimethoxybenzene |
| SMILES | C#Cc1cc(OC)c(I)c(OC)c1 |
| InChI | InChI=1S/C10H9IO2/c1-4-7-5-8(12-2)10(11)9(6-7)13-3/h1,5-6H,2-3H3 |
| InChIKey | HNVGJIBCVCQLNS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.08 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|