About methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate
methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate (PubChem CID 163616582) has the molecular formula C22H21Br2IO6
and a molecular weight of 668.12 g/mol. Its IUPAC name is methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate |
| PubChem CID | 163616582 |
| Molecular Formula | C22H21Br2IO6 |
| Molecular Weight | 668.12 g/mol |
| Exact Mass | 665.87 |
| IUPAC Name | methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate |
| SMILES | C#Cc1cc(Br)c(CC(=O)OC)c(OC)c1.COC(=O)Cc1c(Br)cc(I)cc1OC |
| InChI | InChI=1S/C12H11BrO3.C10H10BrIO3/c1-4-8-5-10(13)9(7-12(14)16-3)11(6-8)15-2;1-14-9-4-6(12)3-8(11)7(9)5-10(13)15-2/h1,5-6H,7H2,2-3H3;3-4H,5H2,1-2H3 |
| InChIKey | HKNGNSDOOMXTCF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 668.12 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate?
The IUPAC name of methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate (CID 163616582) is methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate.
What is the SMILES notation for methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate?
The canonical SMILES for methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate is C#Cc1cc(Br)c(CC(=O)OC)c(OC)c1.COC(=O)Cc1c(Br)cc(I)cc1OC.
What is the InChIKey of methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate?
The InChIKey is HKNGNSDOOMXTCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO3.C10H10BrIO3/c1-4-8-5-10(13)9(7-12(14)16-3)11(6-8)15-2;1-14-9-4-6(12)3-8(11)7(9)5-10(13)15-2/h1,5-6H,7H2,2-3H3;3-4H,5H2,1-2H3.
What are the key properties of methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate?
methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate has a molecular weight of 668.12 g/mol, XLogP of 4.93, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-bromo-4-ethynyl-6-methoxyphenyl)acetate;methyl 2-(2-bromo-4-iodo-6-methoxyphenyl)acetate is sourced from PubChem (CID 163616582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).