C12H16O2 — CID 91460620
ethane;4-ethynyl-1,2-dimethoxybenzene (PubChem CID 91460620) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;4-ethynyl-1,2-dimethoxybenzene.
| Compound Name | ethane;4-ethynyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 91460620 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | ethane;4-ethynyl-1,2-dimethoxybenzene |
| SMILES | C#Cc1ccc(OC)c(OC)c1.CC |
| InChI | InChI=1S/C10H10O2.C2H6/c1-4-8-5-6-9(11-2)10(7-8)12-3;1-2/h1,5-7H,2-3H3;1-2H3 |
| InChIKey | YNDKJEVIYCCBFC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|