C19H27NO5 — CID 88924483
13-(4-ethynyl-2-methoxyphenyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane (PubChem CID 88924483) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is 13-(4-ethynyl-2-methoxyphenyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane.
| Compound Name | 13-(4-ethynyl-2-methoxyphenyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
|---|---|
| PubChem CID | 88924483 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 13-(4-ethynyl-2-methoxyphenyl)-1,4,7,10-tetraoxa-13-azacyclopentadecane |
| SMILES | C#Cc1ccc(N2CCOCCOCCOCCOCC2)c(OC)c1 |
| InChI | InChI=1S/C19H27NO5/c1-3-17-4-5-18(19(16-17)21-2)20-6-8-22-10-12-24-14-15-25-13-11-23-9-7-20/h1,4-5,16H,6-15H2,2H3 |
| InChIKey | QLVVLKCKLJEZAT-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|