C20H19N3O2S — CID 123212667
N-(5-ethynyl-2-methoxyphenyl)-5-morpholin-4-yl-1,3-benzothiazol-2-amine (PubChem CID 123212667) has the molecular formula C20H19N3O2S and a molecular weight of 365.46 g/mol. Its IUPAC name is N-(5-ethynyl-2-methoxyphenyl)-5-morpholin-4-yl-1,3-benzothiazol-2-amine.
| Compound Name | N-(5-ethynyl-2-methoxyphenyl)-5-morpholin-4-yl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 123212667 |
| Molecular Formula | C20H19N3O2S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-(5-ethynyl-2-methoxyphenyl)-5-morpholin-4-yl-1,3-benzothiazol-2-amine |
| SMILES | C#Cc1ccc(OC)c(Nc2nc3cc(N4CCOCC4)ccc3s2)c1 |
| InChI | InChI=1S/C20H19N3O2S/c1-3-14-4-6-18(24-2)16(12-14)21-20-22-17-13-15(5-7-19(17)26-20)23-8-10-25-11-9-23/h1,4-7,12-13H,8-11H2,2H3,(H,21,22) |
| InChIKey | XMWYSAGXSDNIMV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|