C20H19ClN4O3S2 — CID 3941772
5-chloro-2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 3941772) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3941772 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | 5-chloro-2-methoxy-N-[(6-morpholin-4-yl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nc1nc2ccc(N3CCOCC3)cc2s1 |
| InChI | InChI=1S/C20H19ClN4O3S2/c1-27-16-5-2-12(21)10-14(16)18(26)23-19(29)24-20-22-15-4-3-13(11-17(15)30-20)25-6-8-28-9-7-25/h2-5,10-11H,6-9H2,1H3,(H2,22,23,24,26,29) |
| InChIKey | BBADBYAEQQTMKD-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|