C24H22ClN5O3S — CID 171532777
2-chloro-5-methoxy-6-methyl-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-pyridin-4-ylpyridine-3-carboxamide (PubChem CID 171532777) has the molecular formula C24H22ClN5O3S and a molecular weight of 495.99 g/mol. Its IUPAC name is 2-chloro-5-methoxy-6-methyl-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-pyridin-4-ylpyridine-3-carboxamide.
| Compound Name | 2-chloro-5-methoxy-6-methyl-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-pyridin-4-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 171532777 |
| Molecular Formula | C24H22ClN5O3S |
| Molecular Weight | 495.99 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | 2-chloro-5-methoxy-6-methyl-N-(6-morpholin-4-yl-1,3-benzothiazol-2-yl)-4-pyridin-4-ylpyridine-3-carboxamide |
| SMILES | COc1c(C)nc(Cl)c(C(=O)Nc2nc3ccc(N4CCOCC4)cc3s2)c1-c1ccncc1 |
| InChI | InChI=1S/C24H22ClN5O3S/c1-14-21(32-2)19(15-5-7-26-8-6-15)20(22(25)27-14)23(31)29-24-28-17-4-3-16(13-18(17)34-24)30-9-11-33-12-10-30/h3-8,13H,9-12H2,1-2H3,(H,28,29,31) |
| InChIKey | WJGAYENLZKYYHU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.99 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|