C14H13FN2O2 — CID 142838776
5-ethynylpyrimidine;4-fluoro-1,2-dimethoxybenzene (PubChem CID 142838776) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 5-ethynylpyrimidine;4-fluoro-1,2-dimethoxybenzene.
| Compound Name | 5-ethynylpyrimidine;4-fluoro-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 142838776 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 5-ethynylpyrimidine;4-fluoro-1,2-dimethoxybenzene |
| SMILES | C#Cc1cncnc1.COc1ccc(F)cc1OC |
| InChI | InChI=1S/C8H9FO2.C6H4N2/c1-10-7-4-3-6(9)5-8(7)11-2;1-2-6-3-7-5-8-4-6/h3-5H,1-2H3;1,3-5H |
| InChIKey | ZMXFDOTWFLBBBX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|