C9H6Cl2O — CID 125479926
1,3-dichloro-5-ethynyl-2-methoxybenzene (PubChem CID 125479926) has the molecular formula C9H6Cl2O and a molecular weight of 201.05 g/mol. Its IUPAC name is 1,3-dichloro-5-ethynyl-2-methoxybenzene.
| Compound Name | 1,3-dichloro-5-ethynyl-2-methoxybenzene |
|---|---|
| PubChem CID | 125479926 |
| Molecular Formula | C9H6Cl2O |
| Molecular Weight | 201.05 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 1,3-dichloro-5-ethynyl-2-methoxybenzene |
| SMILES | C#Cc1cc(Cl)c(OC)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl2O/c1-3-6-4-7(10)9(12-2)8(11)5-6/h1,4-5H,2H3 |
| InChIKey | VGXYSGREWASMJT-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|