C8H5Cl2NOS — CID 139634673
1,3-dichloro-5-isothiocyanato-2-methoxybenzene (PubChem CID 139634673) has the molecular formula C8H5Cl2NOS and a molecular weight of 234.11 g/mol. Its IUPAC name is 1,3-dichloro-5-isothiocyanato-2-methoxybenzene.
| Compound Name | 1,3-dichloro-5-isothiocyanato-2-methoxybenzene |
|---|---|
| PubChem CID | 139634673 |
| Molecular Formula | C8H5Cl2NOS |
| Molecular Weight | 234.11 g/mol |
| Exact Mass | 232.95 |
| IUPAC Name | 1,3-dichloro-5-isothiocyanato-2-methoxybenzene |
| SMILES | COc1c(Cl)cc(N=C=S)cc1Cl |
| InChI | InChI=1S/C8H5Cl2NOS/c1-12-8-6(9)2-5(11-4-13)3-7(8)10/h2-3H,1H3 |
| InChIKey | ONPPGZKRNYAKNT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.11 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|