C15H12Cl3NO — CID 126216572
N-(3-chloro-4-methylphenyl)-1-(3,5-dichloro-4-methoxyphenyl)methanimine (PubChem CID 126216572) has the molecular formula C15H12Cl3NO and a molecular weight of 328.63 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-(3,5-dichloro-4-methoxyphenyl)methanimine.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-(3,5-dichloro-4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 126216572 |
| Molecular Formula | C15H12Cl3NO |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-(3,5-dichloro-4-methoxyphenyl)methanimine |
| SMILES | COc1c(Cl)cc(/C=N/c2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C15H12Cl3NO/c1-9-3-4-11(7-12(9)16)19-8-10-5-13(17)15(20-2)14(18)6-10/h3-8H,1-2H3/b19-8+ |
| InChIKey | KAKZWIARCQJIPR-UFWORHAWSA-N |
| XLogP | 5.71 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|