About (4-methylphenyl) carbamimidothioate;hydrochloride
(4-methylphenyl) carbamimidothioate;hydrochloride (PubChem CID 167442713) has the molecular formula C8H11ClN2S
and a molecular weight of 202.71 g/mol. Its IUPAC name is (4-methylphenyl) carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | (4-methylphenyl) carbamimidothioate;hydrochloride |
| PubChem CID | 167442713 |
| Molecular Formula | C8H11ClN2S |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | (4-methylphenyl) carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C8H10N2S.ClH/c1-6-2-4-7(5-3-6)11-8(9)10;/h2-5H,1H3,(H3,9,10);1H |
| InChIKey | ZLOAUMXUHHSSDJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) carbamimidothioate;hydrochloride?
The IUPAC name of (4-methylphenyl) carbamimidothioate;hydrochloride (CID 167442713) is (4-methylphenyl) carbamimidothioate;hydrochloride.
What is the SMILES notation for (4-methylphenyl) carbamimidothioate;hydrochloride?
The canonical SMILES for (4-methylphenyl) carbamimidothioate;hydrochloride is Cl.[H]/N=C(\N)Sc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) carbamimidothioate;hydrochloride?
The InChIKey is ZLOAUMXUHHSSDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S.ClH/c1-6-2-4-7(5-3-6)11-8(9)10;/h2-5H,1H3,(H3,9,10);1H.
What are the key properties of (4-methylphenyl) carbamimidothioate;hydrochloride?
(4-methylphenyl) carbamimidothioate;hydrochloride has a molecular weight of 202.71 g/mol, XLogP of 2.40, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) carbamimidothioate;hydrochloride is sourced from PubChem (CID 167442713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).