C17H9F3O2S — CID 139943484
2-[4-(trifluoromethyl)phenyl]sulfanylnaphthalene-1,4-dione (PubChem CID 139943484) has the molecular formula C17H9F3O2S and a molecular weight of 334.32 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]sulfanylnaphthalene-1,4-dione.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 139943484 |
| Molecular Formula | C17H9F3O2S |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]sulfanylnaphthalene-1,4-dione |
| SMILES | O=C1C=C(Sc2ccc(C(F)(F)F)cc2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C17H9F3O2S/c18-17(19,20)10-5-7-11(8-6-10)23-15-9-14(21)12-3-1-2-4-13(12)16(15)22/h1-9H |
| InChIKey | VPBICUWPWXFFGN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|