C20H16F3NOS2 — CID 170092101
imino-methyl-oxo-[4-[2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]-λ6-sulfane (PubChem CID 170092101) has the molecular formula C20H16F3NOS2 and a molecular weight of 407.48 g/mol. Its IUPAC name is imino-methyl-oxo-[4-[2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]-λ6-sulfane.
| Compound Name | imino-methyl-oxo-[4-[2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]-λ6-sulfane |
|---|---|
| PubChem CID | 170092101 |
| Molecular Formula | C20H16F3NOS2 |
| Molecular Weight | 407.48 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | imino-methyl-oxo-[4-[2-[4-(trifluoromethyl)phenyl]sulfanylphenyl]phenyl]-λ6-sulfane |
| SMILES | [H]N=S(C)(=O)c1ccc(-c2ccccc2Sc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H16F3NOS2/c1-27(24,25)17-12-6-14(7-13-17)18-4-2-3-5-19(18)26-16-10-8-15(9-11-16)20(21,22)23/h2-13,24H,1H3 |
| InChIKey | VMLINQVZPQIHFP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |