C16H9ClO3S — CID 6481295
2-(4-chlorophenyl)sulfanyl-5-hydroxynaphthalene-1,4-dione (PubChem CID 6481295) has the molecular formula C16H9ClO3S and a molecular weight of 316.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-5-hydroxynaphthalene-1,4-dione.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-5-hydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 6481295 |
| Molecular Formula | C16H9ClO3S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-5-hydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(Sc2ccc(Cl)cc2)=CC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C16H9ClO3S/c17-9-4-6-10(7-5-9)21-14-8-13(19)15-11(16(14)20)2-1-3-12(15)18/h1-8,18H |
| InChIKey | ZVNDQESEJGBAER-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|