C21H20O4S — CID 54177563
5,8-dihydroxy-2-(4-pentylphenyl)sulfanylnaphthalene-1,4-dione (PubChem CID 54177563) has the molecular formula C21H20O4S and a molecular weight of 368.45 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(4-pentylphenyl)sulfanylnaphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-(4-pentylphenyl)sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 54177563 |
| Molecular Formula | C21H20O4S |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 5,8-dihydroxy-2-(4-pentylphenyl)sulfanylnaphthalene-1,4-dione |
| SMILES | CCCCCc1ccc(SC2=CC(=O)c3c(O)ccc(O)c3C2=O)cc1 |
| InChI | InChI=1S/C21H20O4S/c1-2-3-4-5-13-6-8-14(9-7-13)26-18-12-17(24)19-15(22)10-11-16(23)20(19)21(18)25/h6-12,22-23H,2-5H2,1H3 |
| InChIKey | OZMFVYOUCJALJM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|