C15H16O5 — CID 10564379
5,8-dihydroxy-2-(1-hydroxypentyl)naphthalene-1,4-dione (PubChem CID 10564379) has the molecular formula C15H16O5 and a molecular weight of 276.29 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(1-hydroxypentyl)naphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-(1-hydroxypentyl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 10564379 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 5,8-dihydroxy-2-(1-hydroxypentyl)naphthalene-1,4-dione |
| SMILES | CCCCC(O)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C15H16O5/c1-2-3-4-9(16)8-7-12(19)13-10(17)5-6-11(18)14(13)15(8)20/h5-7,9,16-18H,2-4H2,1H3 |
| InChIKey | SMDXZLMYNSQJJS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|