C22H26O6 — CID 67709120
1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)hexyl hex-2-enoate (PubChem CID 67709120) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)hexyl hex-2-enoate.
| Compound Name | 1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)hexyl hex-2-enoate |
|---|---|
| PubChem CID | 67709120 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)hexyl hex-2-enoate |
| SMILES | CCCC=CC(=O)OC(CCCCC)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C22H26O6/c1-3-5-7-9-18(28-19(26)10-8-6-4-2)14-13-17(25)20-15(23)11-12-16(24)21(20)22(14)27/h8,10-13,18,23-24H,3-7,9H2,1-2H3 |
| InChIKey | OSWUMSMZRKGIOG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|