C19H18F2O6 — CID 66547094
[1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2,2-difluoropropanoate (PubChem CID 66547094) has the molecular formula C19H18F2O6 and a molecular weight of 380.34 g/mol. Its IUPAC name is [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2,2-difluoropropanoate.
| Compound Name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2,2-difluoropropanoate |
|---|---|
| PubChem CID | 66547094 |
| Molecular Formula | C19H18F2O6 |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | [1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2,2-difluoropropanoate |
| SMILES | CC(C)=CCC(OC(=O)C(C)(F)F)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C19H18F2O6/c1-9(2)4-7-14(27-18(26)19(3,20)21)10-8-13(24)15-11(22)5-6-12(23)16(15)17(10)25/h4-6,8,14,22-23H,7H2,1-3H3 |
| InChIKey | LAWKMDSTTBLWEZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|