C22H20O6S — CID 71555097
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-thiophen-3-ylacetate (PubChem CID 71555097) has the molecular formula C22H20O6S and a molecular weight of 412.46 g/mol. Its IUPAC name is [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-thiophen-3-ylacetate.
| Compound Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-thiophen-3-ylacetate |
|---|---|
| PubChem CID | 71555097 |
| Molecular Formula | C22H20O6S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] 2-thiophen-3-ylacetate |
| SMILES | CC(C)=CC[C@@H](OC(=O)Cc1ccsc1)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C22H20O6S/c1-12(2)3-6-18(28-19(26)9-13-7-8-29-11-13)14-10-17(25)20-15(23)4-5-16(24)21(20)22(14)27/h3-5,7-8,10-11,18,23-24H,6,9H2,1-2H3/t18-/m1/s1 |
| InChIKey | QYMMHWJBABSHFS-GOSISDBHSA-N |
| XLogP | 3.98 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|