C23H20ClNO6 — CID 46191120
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(3-chlorophenyl)carbamate (PubChem CID 46191120) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(3-chlorophenyl)carbamate.
| Compound Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(3-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 46191120 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] N-(3-chlorophenyl)carbamate |
| SMILES | CC(C)=CC[C@@H](OC(=O)Nc1cccc(Cl)c1)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C23H20ClNO6/c1-12(2)6-9-19(31-23(30)25-14-5-3-4-13(24)10-14)15-11-18(28)20-16(26)7-8-17(27)21(20)22(15)29/h3-8,10-11,19,26-27H,9H2,1-2H3,(H,25,30)/t19-/m1/s1 |
| InChIKey | VNXDETQMUXKBQD-LJQANCHMSA-N |
| XLogP | 5.03 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|