C16H19O9P — CID 174804181
5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione;phosphoric acid (PubChem CID 174804181) has the molecular formula C16H19O9P and a molecular weight of 386.29 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione;phosphoric acid.
| Compound Name | 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 174804181 |
| Molecular Formula | C16H19O9P |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 5,8-dihydroxy-2-(1-hydroxy-4-methylpent-3-enyl)naphthalene-1,4-dione;phosphoric acid |
| SMILES | CC(C)=CCC(O)C1=CC(=O)c2c(O)ccc(O)c2C1=O.O=P(O)(O)O |
| InChI | InChI=1S/C16H16O5.H3O4P/c1-8(2)3-4-10(17)9-7-13(20)14-11(18)5-6-12(19)15(14)16(9)21;1-5(2,3)4/h3,5-7,10,17-19H,4H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | FGCGUCGMKCBUCC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|