C27H23ClO7 — CID 155561750
[(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(5-chloro-2-methylphenyl)-4-oxobut-2-enoate (PubChem CID 155561750) has the molecular formula C27H23ClO7 and a molecular weight of 494.93 g/mol. Its IUPAC name is [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(5-chloro-2-methylphenyl)-4-oxobut-2-enoate.
| Compound Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(5-chloro-2-methylphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 155561750 |
| Molecular Formula | C27H23ClO7 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | [(1R)-1-(5,8-dihydroxy-1,4-dioxonaphthalen-2-yl)-4-methylpent-3-enyl] (Z)-4-(5-chloro-2-methylphenyl)-4-oxobut-2-enoate |
| SMILES | CC(C)=CC[C@@H](OC(=O)/C=C\C(=O)c1cc(Cl)ccc1C)C1=CC(=O)c2c(O)ccc(O)c2C1=O |
| InChI | InChI=1S/C27H23ClO7/c1-14(2)4-10-23(18-13-22(32)25-20(30)7-8-21(31)26(25)27(18)34)35-24(33)11-9-19(29)17-12-16(28)6-5-15(17)3/h4-9,11-13,23,30-31H,10H2,1-3H3/b11-9-/t23-/m1/s1 |
| InChIKey | KKISNJGIWVVAJH-VLRJHWBUSA-N |
| XLogP | 5.07 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|