C17H21ClO — CID 164580052
(2E)-4-(5-chloro-2-methylphenyl)-2,7-dimethylocta-2,6-dienal (PubChem CID 164580052) has the molecular formula C17H21ClO and a molecular weight of 276.81 g/mol. Its IUPAC name is (2E)-4-(5-chloro-2-methylphenyl)-2,7-dimethylocta-2,6-dienal.
| Compound Name | (2E)-4-(5-chloro-2-methylphenyl)-2,7-dimethylocta-2,6-dienal |
|---|---|
| PubChem CID | 164580052 |
| Molecular Formula | C17H21ClO |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (2E)-4-(5-chloro-2-methylphenyl)-2,7-dimethylocta-2,6-dienal |
| SMILES | CC(C)=CCC(/C=C(\C)C=O)c1cc(Cl)ccc1C |
| InChI | InChI=1S/C17H21ClO/c1-12(2)5-7-15(9-13(3)11-19)17-10-16(18)8-6-14(17)4/h5-6,8-11,15H,7H2,1-4H3/b13-9+ |
| InChIKey | PEXSIKXSMGFCSI-UKTHLTGXSA-N |
| XLogP | 5.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|