C28H24O4S2 — CID 11431787
5,8-dihydroxy-2-(4-methyl-1-phenylsulfanylpent-3-enyl)-7-phenylsulfanylnaphthalene-1,4-dione (PubChem CID 11431787) has the molecular formula C28H24O4S2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(4-methyl-1-phenylsulfanylpent-3-enyl)-7-phenylsulfanylnaphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-(4-methyl-1-phenylsulfanylpent-3-enyl)-7-phenylsulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11431787 |
| Molecular Formula | C28H24O4S2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 5,8-dihydroxy-2-(4-methyl-1-phenylsulfanylpent-3-enyl)-7-phenylsulfanylnaphthalene-1,4-dione |
| SMILES | CC(C)=CCC(Sc1ccccc1)C1=CC(=O)c2c(O)cc(Sc3ccccc3)c(O)c2C1=O |
| InChI | InChI=1S/C28H24O4S2/c1-17(2)13-14-23(33-18-9-5-3-6-10-18)20-15-21(29)25-22(30)16-24(28(32)26(25)27(20)31)34-19-11-7-4-8-12-19/h3-13,15-16,23,30,32H,14H2,1-2H3 |
| InChIKey | QWJSFTYVCIMITB-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|