C32H32O4S2 — CID 53353261
6-(2,6-dimethylphenyl)sulfanyl-2-[1-(2,6-dimethylphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 53353261) has the molecular formula C32H32O4S2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 6-(2,6-dimethylphenyl)sulfanyl-2-[1-(2,6-dimethylphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 6-(2,6-dimethylphenyl)sulfanyl-2-[1-(2,6-dimethylphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 53353261 |
| Molecular Formula | C32H32O4S2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 6-(2,6-dimethylphenyl)sulfanyl-2-[1-(2,6-dimethylphenyl)sulfanyl-4-methylpent-3-enyl]-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CC(C)=CCC(Sc1c(C)cccc1C)C1=CC(=O)c2c(O)c(Sc3c(C)cccc3C)cc(O)c2C1=O |
| InChI | InChI=1S/C32H32O4S2/c1-17(2)13-14-25(37-31-18(3)9-7-10-19(31)4)22-15-23(33)28-27(29(22)35)24(34)16-26(30(28)36)38-32-20(5)11-8-12-21(32)6/h7-13,15-16,25,34,36H,14H2,1-6H3 |
| InChIKey | PPIOTXRHDRGCQW-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|